C16H20N2O4S2 — CID 142096228
N-[5-methoxy-3-(4-phenoxypiperidin-1-yl)sulfanylthiophen-2-yl]oxyhydroxylamine (PubChem CID 142096228) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[5-methoxy-3-(4-phenoxypiperidin-1-yl)sulfanylthiophen-2-yl]oxyhydroxylamine.
| Compound Name | N-[5-methoxy-3-(4-phenoxypiperidin-1-yl)sulfanylthiophen-2-yl]oxyhydroxylamine |
|---|---|
| PubChem CID | 142096228 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[5-methoxy-3-(4-phenoxypiperidin-1-yl)sulfanylthiophen-2-yl]oxyhydroxylamine |
| SMILES | COc1cc(SN2CCC(Oc3ccccc3)CC2)c(ONO)s1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-20-15-11-14(16(23-15)22-17-19)24-18-9-7-13(8-10-18)21-12-5-3-2-4-6-12/h2-6,11,13,17,19H,7-10H2,1H3 |
| InChIKey | WXTNMHZHOUQEOG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|