C16H21F3N2O4S2 — CID 18723073
[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate (PubChem CID 18723073) has the molecular formula C16H21F3N2O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is [4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate.
| Compound Name | [4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate |
|---|---|
| PubChem CID | 18723073 |
| Molecular Formula | C16H21F3N2O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate |
| SMILES | CC(C)(C(=O)NO)S(=O)ON1CCC(Sc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F3N2O4S2/c1-15(2,14(22)20-23)27(24)25-21-9-7-13(8-10-21)26-12-5-3-11(4-6-12)16(17,18)19/h3-6,13,23H,7-10H2,1-2H3,(H,20,22) |
| InChIKey | JIUUZHSNLJXWAE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|