C22H25F3N2O4S2 — CID 59096974
N-hydroxy-2-[2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylphenyl]butanamide (PubChem CID 59096974) has the molecular formula C22H25F3N2O4S2 and a molecular weight of 502.58 g/mol. Its IUPAC name is N-hydroxy-2-[2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylphenyl]butanamide.
| Compound Name | N-hydroxy-2-[2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylphenyl]butanamide |
|---|---|
| PubChem CID | 59096974 |
| Molecular Formula | C22H25F3N2O4S2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-hydroxy-2-[2-[4-[4-(trifluoromethyl)phenyl]sulfanylpiperidin-1-yl]sulfonylphenyl]butanamide |
| SMILES | CCC(C(=O)NO)c1ccccc1S(=O)(=O)N1CCC(Sc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H25F3N2O4S2/c1-2-18(21(28)26-29)19-5-3-4-6-20(19)33(30,31)27-13-11-17(12-14-27)32-16-9-7-15(8-10-16)22(23,24)25/h3-10,17-18,29H,2,11-14H2,1H3,(H,26,28) |
| InChIKey | ICQDXXTVXFMJRW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|