C15H22F3NO3S2 — CID 142266575
ethane;[4-(1-methylpiperidin-4-yl)sulfanylphenyl] trifluoromethanesulfonate (PubChem CID 142266575) has the molecular formula C15H22F3NO3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is ethane;[4-(1-methylpiperidin-4-yl)sulfanylphenyl] trifluoromethanesulfonate.
| Compound Name | ethane;[4-(1-methylpiperidin-4-yl)sulfanylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142266575 |
| Molecular Formula | C15H22F3NO3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | ethane;[4-(1-methylpiperidin-4-yl)sulfanylphenyl] trifluoromethanesulfonate |
| SMILES | CC.CN1CCC(Sc2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C13H16F3NO3S2.C2H6/c1-17-8-6-12(7-9-17)21-11-4-2-10(3-5-11)20-22(18,19)13(14,15)16;1-2/h2-5,12H,6-9H2,1H3;1-2H3 |
| InChIKey | UZCMYYURTQFNMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|