C18H27F3N2O4S3 — CID 91501962
ethane;[4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate (PubChem CID 91501962) has the molecular formula C18H27F3N2O4S3 and a molecular weight of 488.62 g/mol. Its IUPAC name is ethane;[4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate.
| Compound Name | ethane;[4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate |
|---|---|
| PubChem CID | 91501962 |
| Molecular Formula | C18H27F3N2O4S3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | ethane;[4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxopropane-2-sulfinate |
| SMILES | CC.CC(C)(C(=O)NO)S(=O)ON1CCC(Sc2ccc(SC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F3N2O4S3.C2H6/c1-15(2,14(22)20-23)28(24)25-21-9-7-12(8-10-21)26-11-3-5-13(6-4-11)27-16(17,18)19;1-2/h3-6,12,23H,7-10H2,1-2H3,(H,20,22);1-2H3 |
| InChIKey | CAISELQDRXUYDK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|