C14H17F3N2O5S2 — CID 142009634
N-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperidin-1-yl]sulfonylacetamide (PubChem CID 142009634) has the molecular formula C14H17F3N2O5S2 and a molecular weight of 414.43 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperidin-1-yl]sulfonylacetamide.
| Compound Name | N-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperidin-1-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 142009634 |
| Molecular Formula | C14H17F3N2O5S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]sulfanylpiperidin-1-yl]sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)N1CCC(Sc2ccc(OC(F)(F)F)cc2)CC1)NO |
| InChI | InChI=1S/C14H17F3N2O5S2/c15-14(16,17)24-10-1-3-11(4-2-10)25-12-5-7-19(8-6-12)26(22,23)9-13(20)18-21/h1-4,12,21H,5-9H2,(H,18,20) |
| InChIKey | KCDIDTJHZWWHJD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|