C17H23F3N2O4S — CID 52516209
2-(4-methylpiperidin-1-yl)sulfonyl-N-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 52516209) has the molecular formula C17H23F3N2O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)sulfonyl-N-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)sulfonyl-N-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 52516209 |
| Molecular Formula | C17H23F3N2O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)sulfonyl-N-[(1R)-1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | CC1CCN(S(=O)(=O)CC(=O)N[C@H](C)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H23F3N2O4S/c1-12-7-9-22(10-8-12)27(24,25)11-16(23)21-13(2)14-3-5-15(6-4-14)26-17(18,19)20/h3-6,12-13H,7-11H2,1-2H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | KNDPNERAJILFDF-CYBMUJFWSA-N |
| XLogP | 2.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |