C21H26N2O5S — CID 18723052
(4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate (PubChem CID 18723052) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is (4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate.
| Compound Name | (4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 18723052 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
| SMILES | CC(C(=O)NO)(c1ccccc1)S(=O)ON1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O5S/c1-21(20(24)22-25,18-10-6-3-7-11-18)29(26)28-23-14-12-19(13-15-23)27-16-17-8-4-2-5-9-17/h2-11,19,25H,12-16H2,1H3,(H,22,24) |
| InChIKey | KUHYJOMAVOHAQX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|