C24H34N2O5S — CID 91399411
ethane;(4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate (PubChem CID 91399411) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is ethane;(4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate.
| Compound Name | ethane;(4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 91399411 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | ethane;(4-phenylmethoxypiperidin-1-yl) 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate |
| SMILES | CC.CC(Cc1ccccc1)(C(=O)NO)S(=O)ON1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O5S.C2H6/c1-22(21(25)23-26,16-18-8-4-2-5-9-18)30(27)29-24-14-12-20(13-15-24)28-17-19-10-6-3-7-11-19;1-2/h2-11,20,26H,12-17H2,1H3,(H,23,25);1-2H3 |
| InChIKey | DPVIUPXBHUGASP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|