C21H33NO — CID 13022864
1-[4-(4-tert-butylcyclohexyl)oxyphenyl]piperidine (PubChem CID 13022864) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-[4-(4-tert-butylcyclohexyl)oxyphenyl]piperidine.
| Compound Name | 1-[4-(4-tert-butylcyclohexyl)oxyphenyl]piperidine |
|---|---|
| PubChem CID | 13022864 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 1-[4-(4-tert-butylcyclohexyl)oxyphenyl]piperidine |
| SMILES | CC(C)(C)C1CCC(Oc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H33NO/c1-21(2,3)17-7-11-19(12-8-17)23-20-13-9-18(10-14-20)22-15-5-4-6-16-22/h9-10,13-14,17,19H,4-8,11-12,15-16H2,1-3H3 |
| InChIKey | WKQJRIAUDQXUTQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|