C21H34BNO2 — CID 123813686
[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]pyrrolidin-1-yl]-methylborinic acid (PubChem CID 123813686) has the molecular formula C21H34BNO2 and a molecular weight of 343.32 g/mol. Its IUPAC name is [3-[4-(4-tert-butylcyclohexyl)oxyphenyl]pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [3-[4-(4-tert-butylcyclohexyl)oxyphenyl]pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 123813686 |
| Molecular Formula | C21H34BNO2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | [3-[4-(4-tert-butylcyclohexyl)oxyphenyl]pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(c2ccc(OC3CCC(C(C)(C)C)CC3)cc2)C1 |
| InChI | InChI=1S/C21H34BNO2/c1-21(2,3)18-7-11-20(12-8-18)25-19-9-5-16(6-10-19)17-13-14-23(15-17)22(4)24/h5-6,9-10,17-18,20,24H,7-8,11-15H2,1-4H3 |
| InChIKey | IJKCIUQSXHACEM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|