C19H22BF3N2O2 — CID 58899801
methyl-[4-[4-[(2,4,6-trifluorophenyl)methylamino]phenoxy]piperidin-1-yl]borinic acid (PubChem CID 58899801) has the molecular formula C19H22BF3N2O2 and a molecular weight of 378.20 g/mol. Its IUPAC name is methyl-[4-[4-[(2,4,6-trifluorophenyl)methylamino]phenoxy]piperidin-1-yl]borinic acid.
| Compound Name | methyl-[4-[4-[(2,4,6-trifluorophenyl)methylamino]phenoxy]piperidin-1-yl]borinic acid |
|---|---|
| PubChem CID | 58899801 |
| Molecular Formula | C19H22BF3N2O2 |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl-[4-[4-[(2,4,6-trifluorophenyl)methylamino]phenoxy]piperidin-1-yl]borinic acid |
| SMILES | CB(O)N1CCC(Oc2ccc(NCc3c(F)cc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C19H22BF3N2O2/c1-20(26)25-8-6-16(7-9-25)27-15-4-2-14(3-5-15)24-12-17-18(22)10-13(21)11-19(17)23/h2-5,10-11,16,24,26H,6-9,12H2,1H3 |
| InChIKey | WSVNPEGSCSCFLE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|