C29H31N5O3 — CID 22713185
benzotriazol-1-yl 4-[4-(4-cyclohexyloxyphenyl)piperazin-1-yl]benzoate (PubChem CID 22713185) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[4-(4-cyclohexyloxyphenyl)piperazin-1-yl]benzoate.
| Compound Name | benzotriazol-1-yl 4-[4-(4-cyclohexyloxyphenyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 22713185 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | benzotriazol-1-yl 4-[4-(4-cyclohexyloxyphenyl)piperazin-1-yl]benzoate |
| SMILES | O=C(On1nnc2ccccc21)c1ccc(N2CCN(c3ccc(OC4CCCCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H31N5O3/c35-29(37-34-28-9-5-4-8-27(28)30-31-34)22-10-12-23(13-11-22)32-18-20-33(21-19-32)24-14-16-26(17-15-24)36-25-6-2-1-3-7-25/h4-5,8-17,25H,1-3,6-7,18-21H2 |
| InChIKey | SXUDDSXOSBSNSX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|