C33H37N7O3S — CID 87947409
benzotriazol-1-yl 4-[5-[4-[4-(7-methoxyheptyl)piperazin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 87947409) has the molecular formula C33H37N7O3S and a molecular weight of 611.77 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[5-[4-[4-(7-methoxyheptyl)piperazin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | benzotriazol-1-yl 4-[5-[4-[4-(7-methoxyheptyl)piperazin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 87947409 |
| Molecular Formula | C33H37N7O3S |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | benzotriazol-1-yl 4-[5-[4-[4-(7-methoxyheptyl)piperazin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COCCCCCCCN1CCN(c2ccc(-c3nnc(-c4ccc(C(=O)On5nnc6ccccc65)cc4)s3)cc2)CC1 |
| InChI | InChI=1S/C33H37N7O3S/c1-42-24-8-4-2-3-7-19-38-20-22-39(23-21-38)28-17-15-26(16-18-28)32-36-35-31(44-32)25-11-13-27(14-12-25)33(41)43-40-30-10-6-5-9-29(30)34-37-40/h5-6,9-18H,2-4,7-8,19-24H2,1H3 |
| InChIKey | KBFHDORAEIUNCX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|