C27H33N3O4S — CID 22492994
methyl 4-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 22492994) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is methyl 4-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 22492994 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | methyl 4-[5-[4-[4-(4-methoxybutoxymethyl)piperidin-1-yl]phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COCCCCOCC1CCN(c2ccc(-c3nnc(-c4ccc(C(=O)OC)cc4)s3)cc2)CC1 |
| InChI | InChI=1S/C27H33N3O4S/c1-32-17-3-4-18-34-19-20-13-15-30(16-14-20)24-11-9-22(10-12-24)26-29-28-25(35-26)21-5-7-23(8-6-21)27(31)33-2/h5-12,20H,3-4,13-19H2,1-2H3 |
| InChIKey | DDUNNGGSXYEILX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|