C13H13N3O3S — CID 139271005
methyl 4-[5-(acetamidomethyl)-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 139271005) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is methyl 4-[5-(acetamidomethyl)-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-(acetamidomethyl)-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 139271005 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 4-[5-(acetamidomethyl)-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(CNC(C)=O)s2)cc1 |
| InChI | InChI=1S/C13H13N3O3S/c1-8(17)14-7-11-15-16-12(20-11)9-3-5-10(6-4-9)13(18)19-2/h3-6H,7H2,1-2H3,(H,14,17) |
| InChIKey | VNLDHVSSHYDWCW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |