C18H15N3O3S — CID 146872756
methyl 2-amino-4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)acetyl]benzoate (PubChem CID 146872756) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 2-amino-4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)acetyl]benzoate.
| Compound Name | methyl 2-amino-4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)acetyl]benzoate |
|---|---|
| PubChem CID | 146872756 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methyl 2-amino-4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)acetyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Cc2nnc(-c3ccccc3)s2)cc1N |
| InChI | InChI=1S/C18H15N3O3S/c1-24-18(23)13-8-7-12(9-14(13)19)15(22)10-16-20-21-17(25-16)11-5-3-2-4-6-11/h2-9H,10,19H2,1H3 |
| InChIKey | SONULKNZOHYOLE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|