About [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid
[5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid (PubChem CID 136641585) has the molecular formula C10H9N3O3S
and a molecular weight of 251.27 g/mol. Its IUPAC name is [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid.
Analyze [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid?
The IUPAC name of [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid (CID 136641585) is [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid.
What is the SMILES notation for [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid?
The canonical SMILES for [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid is O=C(O)NCc1nnc(-c2ccc(O)cc2)s1.
What is the InChIKey of [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid?
The InChIKey is BFYDOLWKIUBWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3S/c14-7-3-1-6(2-4-7)9-13-12-8(17-9)5-11-10(15)16/h1-4,11,14H,5H2,(H,15,16).
What are the key properties of [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid?
[5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid has a molecular weight of 251.27 g/mol, XLogP of 1.68, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]methylcarbamic acid is sourced from PubChem (CID 136641585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).