C17H12FN3O2S — CID 123918704
2-fluoro-N-[[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]methyl]benzamide (PubChem CID 123918704) has the molecular formula C17H12FN3O2S and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-fluoro-N-[[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]methyl]benzamide.
| Compound Name | 2-fluoro-N-[[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 123918704 |
| Molecular Formula | C17H12FN3O2S |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-fluoro-N-[[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]methyl]benzamide |
| SMILES | O=Cc1ccc(-c2nnc(CNC(=O)c3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C17H12FN3O2S/c18-14-4-2-1-3-13(14)16(23)19-9-15-20-21-17(24-15)12-7-5-11(10-22)6-8-12/h1-8,10H,9H2,(H,19,23) |
| InChIKey | YKRLVUZKLRWCDS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|