C18H13ClFN3O2S — CID 90903249
3-(2-chloroethyl)-2-fluoro-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 90903249) has the molecular formula C18H13ClFN3O2S and a molecular weight of 389.84 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2-fluoro-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-(2-chloroethyl)-2-fluoro-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 90903249 |
| Molecular Formula | C18H13ClFN3O2S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 3-(2-chloroethyl)-2-fluoro-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=Cc1ccc(-c2nnc(NC(=O)c3cccc(CCCl)c3F)s2)cc1 |
| InChI | InChI=1S/C18H13ClFN3O2S/c19-9-8-12-2-1-3-14(15(12)20)16(25)21-18-23-22-17(26-18)13-6-4-11(10-24)5-7-13/h1-7,10H,8-9H2,(H,21,23,25) |
| InChIKey | JBJAUWRNBRZIMN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|