C21H20FN3O3S — CID 142787566
methyl 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 142787566) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 142787566 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 4-[5-[(3-butyl-2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | CCCCc1cccc(C(=O)Nc2nnc(-c3ccc(C(=O)OC)cc3)s2)c1F |
| InChI | InChI=1S/C21H20FN3O3S/c1-3-4-6-13-7-5-8-16(17(13)22)18(26)23-21-25-24-19(29-21)14-9-11-15(12-10-14)20(27)28-2/h5,7-12H,3-4,6H2,1-2H3,(H,23,25,26) |
| InChIKey | KUALISZIHTVYFM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |