C13H13Cl2N3OS — CID 26197202
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,3-dichlorobenzamide (PubChem CID 26197202) has the molecular formula C13H13Cl2N3OS and a molecular weight of 330.24 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,3-dichlorobenzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 26197202 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,3-dichlorobenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2cccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-2-3-7-10-17-18-13(20-10)16-12(19)8-5-4-6-9(14)11(8)15/h4-6H,2-3,7H2,1H3,(H,16,18,19) |
| InChIKey | RWGZARMOCOYUKV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |