C12H15N3O2S — CID 31039084
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-methylfuran-3-carboxamide (PubChem CID 31039084) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 31039084 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-methylfuran-3-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccoc2C)s1 |
| InChI | InChI=1S/C12H15N3O2S/c1-3-4-5-10-14-15-12(18-10)13-11(16)9-6-7-17-8(9)2/h6-7H,3-5H2,1-2H3,(H,13,15,16) |
| InChIKey | ZHPZTDQCGUUQKY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |