C13H13BrFN3OS — CID 18198071
2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide (PubChem CID 18198071) has the molecular formula C13H13BrFN3OS and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide.
| Compound Name | 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 18198071 |
| Molecular Formula | C13H13BrFN3OS |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccc(F)cc2Br)s1 |
| InChI | InChI=1S/C13H13BrFN3OS/c1-2-3-4-11-17-18-13(20-11)16-12(19)9-6-5-8(15)7-10(9)14/h5-7H,2-4H2,1H3,(H,16,18,19) |
| InChIKey | KMQDEZMNPQJLAQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |