C14H16BrN3O2S — CID 26197074
2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-methoxybenzamide (PubChem CID 26197074) has the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. Its IUPAC name is 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-methoxybenzamide.
| Compound Name | 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 26197074 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-bromo-N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-methoxybenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2cc(OC)ccc2Br)s1 |
| InChI | InChI=1S/C14H16BrN3O2S/c1-3-4-5-12-17-18-14(21-12)16-13(19)10-8-9(20-2)6-7-11(10)15/h6-8H,3-5H2,1-2H3,(H,16,18,19) |
| InChIKey | WFGPKFUPNBSYRO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |