C12H10F3N3OS — CID 108808572
2,3,4-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 108808572) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 108808572 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2,3,4-trifluoro-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCc1nnc(NC(=O)c2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C12H10F3N3OS/c1-2-3-8-17-18-12(20-8)16-11(19)6-4-5-7(13)10(15)9(6)14/h4-5H,2-3H2,1H3,(H,16,18,19) |
| InChIKey | HFCYIZHPBFINCZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|