C16H17N5OS — CID 134698300
N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoxaline-5-carboxamide (PubChem CID 134698300) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoxaline-5-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 134698300 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoxaline-5-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cccc3nccnc23)s1 |
| InChI | InChI=1S/C16H17N5OS/c1-2-3-4-8-13-20-21-16(23-13)19-15(22)11-6-5-7-12-14(11)18-10-9-17-12/h5-7,9-10H,2-4,8H2,1H3,(H,19,21,22) |
| InChIKey | SDWHIYOQMRKTPG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|