C17H18N4OS — CID 24667862
N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoline-8-carboxamide (PubChem CID 24667862) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoline-8-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 24667862 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)quinoline-8-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cccc3cccnc23)s1 |
| InChI | InChI=1S/C17H18N4OS/c1-2-3-4-10-14-20-21-17(23-14)19-16(22)13-9-5-7-12-8-6-11-18-15(12)13/h5-9,11H,2-4,10H2,1H3,(H,19,21,22) |
| InChIKey | SNFUACMWLMJDKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|