C18H27N5OS — CID 60553366
2-(dimethylamino)-N-(5-octyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 60553366) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(5-octyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-(dimethylamino)-N-(5-octyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60553366 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-(dimethylamino)-N-(5-octyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2cccnc2N(C)C)s1 |
| InChI | InChI=1S/C18H27N5OS/c1-4-5-6-7-8-9-12-15-21-22-18(25-15)20-17(24)14-11-10-13-19-16(14)23(2)3/h10-11,13H,4-9,12H2,1-3H3,(H,20,22,24) |
| InChIKey | UCLABBQKUCILAW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|