C21H20FN3O3S — CID 123943347
N-[2-[5-[3,5-dimethyl-4-(2-oxoethoxy)phenyl]-1,3,4-thiadiazol-2-yl]ethyl]-2-fluorobenzamide (PubChem CID 123943347) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[2-[5-[3,5-dimethyl-4-(2-oxoethoxy)phenyl]-1,3,4-thiadiazol-2-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[5-[3,5-dimethyl-4-(2-oxoethoxy)phenyl]-1,3,4-thiadiazol-2-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123943347 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[2-[5-[3,5-dimethyl-4-(2-oxoethoxy)phenyl]-1,3,4-thiadiazol-2-yl]ethyl]-2-fluorobenzamide |
| SMILES | Cc1cc(-c2nnc(CCNC(=O)c3ccccc3F)s2)cc(C)c1OCC=O |
| InChI | InChI=1S/C21H20FN3O3S/c1-13-11-15(12-14(2)19(13)28-10-9-26)21-25-24-18(29-21)7-8-23-20(27)16-5-3-4-6-17(16)22/h3-6,9,11-12H,7-8,10H2,1-2H3,(H,23,27) |
| InChIKey | SCPKEDLCAYXVJM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|