C28H34F3N2O5S2+ — CID 159030739
bis[4-(dimethylamino)phenyl]-[4-(oxolan-2-yloxy)phenyl]sulfanium;2,2,2-trifluoroethanesulfonic acid (PubChem CID 159030739) has the molecular formula C28H34F3N2O5S2+ and a molecular weight of 599.72 g/mol. Its IUPAC name is bis[4-(dimethylamino)phenyl]-[4-(oxolan-2-yloxy)phenyl]sulfanium;2,2,2-trifluoroethanesulfonic acid.
| Compound Name | bis[4-(dimethylamino)phenyl]-[4-(oxolan-2-yloxy)phenyl]sulfanium;2,2,2-trifluoroethanesulfonic acid |
|---|---|
| PubChem CID | 159030739 |
| Molecular Formula | C28H34F3N2O5S2+ |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | bis[4-(dimethylamino)phenyl]-[4-(oxolan-2-yloxy)phenyl]sulfanium;2,2,2-trifluoroethanesulfonic acid |
| SMILES | CN(C)c1ccc([S+](c2ccc(OC3CCCO3)cc2)c2ccc(N(C)C)cc2)cc1.O=S(=O)(O)CC(F)(F)F |
| InChI | InChI=1S/C26H31N2O2S.C2H3F3O3S/c1-27(2)20-7-13-23(14-8-20)31(24-15-9-21(10-16-24)28(3)4)25-17-11-22(12-18-25)30-26-6-5-19-29-26;3-2(4,5)1-9(6,7)8/h7-18,26H,5-6,19H2,1-4H3;1H2,(H,6,7,8)/q+1; |
| InChIKey | JUVVEBZGGGHLEE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|