C30H12F10O6S2 — CID 173069834
[4-[2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]phenyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 173069834) has the molecular formula C30H12F10O6S2 and a molecular weight of 722.53 g/mol. Its IUPAC name is [4-[2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]phenyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [4-[2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]phenyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 173069834 |
| Molecular Formula | C30H12F10O6S2 |
| Molecular Weight | 722.53 g/mol |
| Exact Mass | 721.99 |
| IUPAC Name | [4-[2-[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]phenyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccccc2-c2ccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H12F10O6S2/c31-19-21(33)25(37)29(26(38)22(19)34)47(41,42)45-15-9-5-13(6-10-15)17-3-1-2-4-18(17)14-7-11-16(12-8-14)46-48(43,44)30-27(39)23(35)20(32)24(36)28(30)40/h1-12H |
| InChIKey | LIDKKHFKMIQZMG-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.53 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|