C21H11F8NO7S2 — CID 20811040
[4-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 20811040) has the molecular formula C21H11F8NO7S2 and a molecular weight of 605.44 g/mol. Its IUPAC name is [4-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [4-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 20811040 |
| Molecular Formula | C21H11F8NO7S2 |
| Molecular Weight | 605.44 g/mol |
| Exact Mass | 604.98 |
| IUPAC Name | [4-[(Z)-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino]oxysulfonylphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | COc1ccc(/C(=N/OS(=O)(=O)c2ccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H11F8NO7S2/c1-35-11-4-2-10(3-5-11)20(21(27,28)29)30-37-38(31,32)13-8-6-12(7-9-13)36-39(33,34)19-17(25)15(23)14(22)16(24)18(19)26/h2-9H,1H3/b30-20- |
| InChIKey | ZRHZIHWDKLREQV-COEJQBHMSA-N |
| XLogP | 4.83 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|