C16H14F3NO4S2 — CID 140521128
[(Z)-[2,2,2-trifluoro-1-[4-(sulfanylmethyl)phenyl]ethylidene]amino] 4-methoxybenzenesulfonate (PubChem CID 140521128) has the molecular formula C16H14F3NO4S2 and a molecular weight of 405.42 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-(sulfanylmethyl)phenyl]ethylidene]amino] 4-methoxybenzenesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-(sulfanylmethyl)phenyl]ethylidene]amino] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 140521128 |
| Molecular Formula | C16H14F3NO4S2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-(sulfanylmethyl)phenyl]ethylidene]amino] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)O/N=C(/c2ccc(CS)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO4S2/c1-23-13-6-8-14(9-7-13)26(21,22)24-20-15(16(17,18)19)12-4-2-11(10-25)3-5-12/h2-9,25H,10H2,1H3/b20-15- |
| InChIKey | GFSBTTJWKBKTSL-HKWRFOASSA-N |
| XLogP | 3.80 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|