C33H24F6N2O7S2 — CID 134520723
[(2,2,2-trifluoro-1-phenylethylidene)amino] 4-methoxybenzenesulfonate;[(2,2,2-trifluoro-1-phenylethylidene)amino] naphthalene-1-sulfonate (PubChem CID 134520723) has the molecular formula C33H24F6N2O7S2 and a molecular weight of 738.68 g/mol. Its IUPAC name is [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-methoxybenzenesulfonate;[(2,2,2-trifluoro-1-phenylethylidene)amino] naphthalene-1-sulfonate.
| Compound Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-methoxybenzenesulfonate;[(2,2,2-trifluoro-1-phenylethylidene)amino] naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 134520723 |
| Molecular Formula | C33H24F6N2O7S2 |
| Molecular Weight | 738.68 g/mol |
| Exact Mass | 738.09 |
| IUPAC Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-methoxybenzenesulfonate;[(2,2,2-trifluoro-1-phenylethylidene)amino] naphthalene-1-sulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON=C(c2ccccc2)C(F)(F)F)cc1.O=S(=O)(ON=C(c1ccccc1)C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H12F3NO3S.C15H12F3NO4S/c19-18(20,21)17(14-8-2-1-3-9-14)22-25-26(23,24)16-12-6-10-13-7-4-5-11-15(13)16;1-22-12-7-9-13(10-8-12)24(20,21)23-19-14(15(16,17)18)11-5-3-2-4-6-11/h1-12H;2-10H,1H3 |
| InChIKey | MAJMYKKRMNZDOY-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.68 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|