C18H17F3N2O3S — CID 172963344
[(Z)-[1-[3-(C,N-dimethylcarbonimidoyl)phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 172963344) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is [(Z)-[1-[3-(C,N-dimethylcarbonimidoyl)phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-[1-[3-(C,N-dimethylcarbonimidoyl)phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 172963344 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(Z)-[1-[3-(C,N-dimethylcarbonimidoyl)phenyl]-2,2,2-trifluoroethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | C/N=C(\C)c1cccc(/C(=N/OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O3S/c1-12-7-9-16(10-8-12)27(24,25)26-23-17(18(19,20)21)15-6-4-5-14(11-15)13(2)22-3/h4-11H,1-3H3/b22-13+,23-17- |
| InChIKey | DLQLWZDZSVHYJT-WMNOFMDASA-N |
| XLogP | 4.11 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|