C15H16N2O3S — CID 72519095
[1-(5-methyl-3-pyridinyl)ethylideneamino] 4-methylbenzenesulfonate (PubChem CID 72519095) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is [1-(5-methyl-3-pyridinyl)ethylideneamino] 4-methylbenzenesulfonate.
| Compound Name | [1-(5-methyl-3-pyridinyl)ethylideneamino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 72519095 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [1-(5-methyl-3-pyridinyl)ethylideneamino] 4-methylbenzenesulfonate |
| SMILES | CC(=NOS(=O)(=O)c1ccc(C)cc1)c1cncc(C)c1 |
| InChI | InChI=1S/C15H16N2O3S/c1-11-4-6-15(7-5-11)21(18,19)20-17-13(3)14-8-12(2)9-16-10-14/h4-10H,1-3H3 |
| InChIKey | NOCWZJICTYLYBN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|