About (propan-2-ylideneamino) 4-chlorobenzenesulfonate
(propan-2-ylideneamino) 4-chlorobenzenesulfonate (PubChem CID 155902962) has the molecular formula C9H10ClNO3S
and a molecular weight of 247.70 g/mol. Its IUPAC name is (propan-2-ylideneamino) 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) 4-chlorobenzenesulfonate |
| PubChem CID | 155902962 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | (propan-2-ylideneamino) 4-chlorobenzenesulfonate |
| SMILES | CC(C)=NOS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClNO3S/c1-7(2)11-14-15(12,13)9-5-3-8(10)4-6-9/h3-6H,1-2H3 |
| InChIKey | NOTIFEQFWZHBIM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) 4-chlorobenzenesulfonate?
The IUPAC name of (propan-2-ylideneamino) 4-chlorobenzenesulfonate (CID 155902962) is (propan-2-ylideneamino) 4-chlorobenzenesulfonate.
What is the SMILES notation for (propan-2-ylideneamino) 4-chlorobenzenesulfonate?
The canonical SMILES for (propan-2-ylideneamino) 4-chlorobenzenesulfonate is CC(C)=NOS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of (propan-2-ylideneamino) 4-chlorobenzenesulfonate?
The InChIKey is NOTIFEQFWZHBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO3S/c1-7(2)11-14-15(12,13)9-5-3-8(10)4-6-9/h3-6H,1-2H3.
What are the key properties of (propan-2-ylideneamino) 4-chlorobenzenesulfonate?
(propan-2-ylideneamino) 4-chlorobenzenesulfonate has a molecular weight of 247.70 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) 4-chlorobenzenesulfonate is sourced from PubChem (CID 155902962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).