C19H29NO5S — CID 20670583
methyl 2-ethyl-2,4-dimethyl-4-[4-(propan-2-ylideneamino)oxysulfonylphenyl]pentanoate (PubChem CID 20670583) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is methyl 2-ethyl-2,4-dimethyl-4-[4-(propan-2-ylideneamino)oxysulfonylphenyl]pentanoate.
| Compound Name | methyl 2-ethyl-2,4-dimethyl-4-[4-(propan-2-ylideneamino)oxysulfonylphenyl]pentanoate |
|---|---|
| PubChem CID | 20670583 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | methyl 2-ethyl-2,4-dimethyl-4-[4-(propan-2-ylideneamino)oxysulfonylphenyl]pentanoate |
| SMILES | CCC(C)(CC(C)(C)c1ccc(S(=O)(=O)ON=C(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C19H29NO5S/c1-8-19(6,17(21)24-7)13-18(4,5)15-9-11-16(12-10-15)26(22,23)25-20-14(2)3/h9-12H,8,13H2,1-7H3 |
| InChIKey | OCUNGAMRBNKVIY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|