C22H34O5S — CID 20670584
methyl 4-(4-cyclohexyloxysulfonylphenyl)-2-ethyl-2,4-dimethylpentanoate (PubChem CID 20670584) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is methyl 4-(4-cyclohexyloxysulfonylphenyl)-2-ethyl-2,4-dimethylpentanoate.
| Compound Name | methyl 4-(4-cyclohexyloxysulfonylphenyl)-2-ethyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 20670584 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 4-(4-cyclohexyloxysulfonylphenyl)-2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)(C)c1ccc(S(=O)(=O)OC2CCCCC2)cc1)C(=O)OC |
| InChI | InChI=1S/C22H34O5S/c1-6-22(4,20(23)26-5)16-21(2,3)17-12-14-19(15-13-17)28(24,25)27-18-10-8-7-9-11-18/h12-15,18H,6-11,16H2,1-5H3 |
| InChIKey | DCXHDBOYACJXFI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|