C21H34O3S — CID 15279374
[4-(2,4,4-trimethylpentan-2-yl)cyclohexyl] 4-methylbenzenesulfonate (PubChem CID 15279374) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is [4-(2,4,4-trimethylpentan-2-yl)cyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(2,4,4-trimethylpentan-2-yl)cyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15279374 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [4-(2,4,4-trimethylpentan-2-yl)cyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(C(C)(C)CC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H34O3S/c1-16-7-13-19(14-8-16)25(22,23)24-18-11-9-17(10-12-18)21(5,6)15-20(2,3)4/h7-8,13-14,17-18H,9-12,15H2,1-6H3 |
| InChIKey | QWORJAHXJQRQCM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|