About [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate
[4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 138682829) has the molecular formula C17H23N3O4S
and a molecular weight of 365.46 g/mol. Its IUPAC name is [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate |
| PubChem CID | 138682829 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | CCn1nncc1OC1CCC(OS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-20-17(12-18-19-20)23-14-6-8-15(9-7-14)24-25(21,22)16-10-4-13(2)5-11-16/h4-5,10-12,14-15H,3,6-9H2,1-2H3 |
| InChIKey | ABGMMMLBZVIDSB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate?
The IUPAC name of [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate (CID 138682829) is [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate?
The canonical SMILES for [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate is CCn1nncc1OC1CCC(OS(=O)(=O)c2ccc(C)cc2)CC1.
What is the InChIKey of [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate?
The InChIKey is ABGMMMLBZVIDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O4S/c1-3-20-17(12-18-19-20)23-14-6-8-15(9-7-14)24-25(21,22)16-10-4-13(2)5-11-16/h4-5,10-12,14-15H,3,6-9H2,1-2H3.
What are the key properties of [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate?
[4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate has a molecular weight of 365.46 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-ethyltriazol-4-yl)oxycyclohexyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 138682829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).