C17H19F3N2O3S — CID 177051957
[4-[4-(trifluoromethyl)pyrazol-1-yl]cyclohexyl] 4-methylbenzenesulfonate (PubChem CID 177051957) has the molecular formula C17H19F3N2O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is [4-[4-(trifluoromethyl)pyrazol-1-yl]cyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[4-(trifluoromethyl)pyrazol-1-yl]cyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 177051957 |
| Molecular Formula | C17H19F3N2O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [4-[4-(trifluoromethyl)pyrazol-1-yl]cyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(n3cc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C17H19F3N2O3S/c1-12-2-8-16(9-3-12)26(23,24)25-15-6-4-14(5-7-15)22-11-13(10-21-22)17(18,19)20/h2-3,8-11,14-15H,4-7H2,1H3 |
| InChIKey | WJKDHUHWADRFMF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|