C13H16F2O3S — CID 89368962
[(1S,3R)-3-(difluoromethyl)cyclopentyl] 4-methylbenzenesulfonate (PubChem CID 89368962) has the molecular formula C13H16F2O3S and a molecular weight of 290.33 g/mol. Its IUPAC name is [(1S,3R)-3-(difluoromethyl)cyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3R)-3-(difluoromethyl)cyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89368962 |
| Molecular Formula | C13H16F2O3S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [(1S,3R)-3-(difluoromethyl)cyclopentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@@H](C(F)F)C2)cc1 |
| InChI | InChI=1S/C13H16F2O3S/c1-9-2-6-12(7-3-9)19(16,17)18-11-5-4-10(8-11)13(14)15/h2-3,6-7,10-11,13H,4-5,8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | XEUWFBKGLKTQDB-MNOVXSKESA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|