C15H23NO4S3 — CID 161470733
[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] 4-methylbenzenesulfonate;sulfane (PubChem CID 161470733) has the molecular formula C15H23NO4S3 and a molecular weight of 377.55 g/mol. Its IUPAC name is [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] 4-methylbenzenesulfonate;sulfane.
| Compound Name | [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] 4-methylbenzenesulfonate;sulfane |
|---|---|
| PubChem CID | 161470733 |
| Molecular Formula | C15H23NO4S3 |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] 4-methylbenzenesulfonate;sulfane |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCN3C(=O)CC[C@H]3C2)cc1.S.S |
| InChI | InChI=1S/C15H19NO4S.2H2S/c1-11-2-5-14(6-3-11)21(18,19)20-13-8-9-16-12(10-13)4-7-15(16)17;;/h2-3,5-6,12-13H,4,7-10H2,1H3;2*1H2/t12-,13-;;/m0../s1 |
| InChIKey | WDAUAYMFTSMICN-NJHZPMQHSA-N |
| XLogP | 2.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|