C20H26N2O3S — CID 154680576
[1-(2-pyridin-4-ylpropan-2-yl)piperidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 154680576) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is [1-(2-pyridin-4-ylpropan-2-yl)piperidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(2-pyridin-4-ylpropan-2-yl)piperidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154680576 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [1-(2-pyridin-4-ylpropan-2-yl)piperidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCN(C(C)(C)c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-16-4-6-19(7-5-16)26(23,24)25-18-10-14-22(15-11-18)20(2,3)17-8-12-21-13-9-17/h4-9,12-13,18H,10-11,14-15H2,1-3H3 |
| InChIKey | TXHUZOXFNRSAEG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|