C15H18F3NO5S — CID 174116849
propan-2-yl 3-methyl-2-[4-(trifluoromethyl)phenyl]sulfonyloxyiminobutanoate (PubChem CID 174116849) has the molecular formula C15H18F3NO5S and a molecular weight of 381.37 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-[4-(trifluoromethyl)phenyl]sulfonyloxyiminobutanoate.
| Compound Name | propan-2-yl 3-methyl-2-[4-(trifluoromethyl)phenyl]sulfonyloxyiminobutanoate |
|---|---|
| PubChem CID | 174116849 |
| Molecular Formula | C15H18F3NO5S |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | propan-2-yl 3-methyl-2-[4-(trifluoromethyl)phenyl]sulfonyloxyiminobutanoate |
| SMILES | CC(C)OC(=O)C(=NOS(=O)(=O)c1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H18F3NO5S/c1-9(2)13(14(20)23-10(3)4)19-24-25(21,22)12-7-5-11(6-8-12)15(16,17)18/h5-10H,1-4H3 |
| InChIKey | PEGCDJYISWAWON-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|