About carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate
carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate (PubChem CID 172944991) has the molecular formula C16H21NO7S
and a molecular weight of 371.41 g/mol. Its IUPAC name is carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate.
Molecular Properties
| Compound Name | carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate |
| PubChem CID | 172944991 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C(\C(=O)OC(C)C)C(C)C)cc1.O=C=O |
| InChI | InChI=1S/C15H21NO5S.CO2/c1-10(2)14(15(17)20-11(3)4)16-21-22(18,19)13-8-6-12(5)7-9-13;2-1-3/h6-11H,1-5H3;/b16-14-; |
| InChIKey | GUZNPBVBMJOHNY-ULQCMBKMSA-N |
| XLogP | 2.08 |
| TPSA | 116.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate?
The IUPAC name of carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate (CID 172944991) is carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate.
What is the SMILES notation for carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate?
The canonical SMILES for carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate is Cc1ccc(S(=O)(=O)O/N=C(\C(=O)OC(C)C)C(C)C)cc1.O=C=O.
What is the InChIKey of carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate?
The InChIKey is GUZNPBVBMJOHNY-ULQCMBKMSA-N. The full InChI is InChI=1S/C15H21NO5S.CO2/c1-10(2)14(15(17)20-11(3)4)16-21-22(18,19)13-8-6-12(5)7-9-13;2-1-3/h6-11H,1-5H3;/b16-14-;.
What are the key properties of carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate?
carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate has a molecular weight of 371.41 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;propan-2-yl (2Z)-3-methyl-2-(4-methylphenyl)sulfonyloxyiminobutanoate is sourced from PubChem (CID 172944991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).