C17H13N3O3S — CID 159199242
[[cyano-[4-(cyanomethyl)phenyl]methylidene]amino] 4-methylbenzenesulfonate (PubChem CID 159199242) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is [[cyano-[4-(cyanomethyl)phenyl]methylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [[cyano-[4-(cyanomethyl)phenyl]methylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159199242 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [[cyano-[4-(cyanomethyl)phenyl]methylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON=C(C#N)c2ccc(CC#N)cc2)cc1 |
| InChI | InChI=1S/C17H13N3O3S/c1-13-2-8-16(9-3-13)24(21,22)23-20-17(12-19)15-6-4-14(5-7-15)10-11-18/h2-9H,10H2,1H3 |
| InChIKey | KPBHUAPKWCNILT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|