C16H11N3O3S2 — CID 171096224
[(E)-[1,3-benzothiazol-7-yl(cyano)methylidene]amino] 4-methylbenzenesulfonate (PubChem CID 171096224) has the molecular formula C16H11N3O3S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is [(E)-[1,3-benzothiazol-7-yl(cyano)methylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[1,3-benzothiazol-7-yl(cyano)methylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171096224 |
| Molecular Formula | C16H11N3O3S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [(E)-[1,3-benzothiazol-7-yl(cyano)methylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C(/C#N)c2cccc3ncsc23)cc1 |
| InChI | InChI=1S/C16H11N3O3S2/c1-11-5-7-12(8-6-11)24(20,21)22-19-15(9-17)13-3-2-4-14-16(13)23-10-18-14/h2-8,10H,1H3/b19-15- |
| InChIKey | FJTOIROKQMYUOS-CYVLTUHYSA-N |
| XLogP | 3.24 |
| TPSA | 92.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|